ChemNet > CAS > 249278-25-9 1- [2-hidroksi-6- (isopentyloxy) fenil] etan-1-satu
249278-25-9 1- [2-hidroksi-6- (isopentyloxy) fenil] etan-1-satu
| Nama produk |
1- [2-hidroksi-6- (isopentyloxy) fenil] etan-1-satu |
| Sinonim |
1- [2-hidroksi-6- (3-methylbutoxy) fenil] etanon |
| Nama bahasa Inggris |
1-[2-hydroxy-6-(isopentyloxy)phenyl]ethan-1-one;1-[2-hydroxy-6-(3-methylbutoxy)phenyl]ethanone |
| MF |
C13H18O3 |
| Berat Molekul |
222.2802 |
| InChI |
InChI=1/C13H18O3/c1-9(2)7-8-16-12-6-4-5-11(15)13(12)10(3)14/h4-6,9,15H,7-8H2,1-3H3 |
| CAS NO |
249278-25-9 |
| Struktur Molekul |
![249278-25-9 1- [2-hidroksi-6- (isopentyloxy) fenil] etan-1-satu](https://images-a.chemnet.com/suppliers/chembase/294/29423.gif)
|
| Kepadatan |
1.059g/cm3 |
| Titik lebur |
25℃ |
| Titik didih |
328°C at 760 mmHg |
| Indeks bias |
1.515 |
| Titik nyala |
118.2°C |
| Tekanan uap |
0.000102mmHg at 25°C |
| Simbol bahaya |
 Xi:Irritant;
|
| Kode Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Keselamatan Deskripsi |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
